About (4-chlorophenyl) [(bromo-λ3-iodanylidene)-λ3-iodanyl]formate
(4-chlorophenyl) [(bromo-λ3-iodanylidene)-λ3-iodanyl]formate (PubChem CID 88730372) has the molecular formula C7H4BrClI2O2
and a molecular weight of 489.27 g/mol. Its IUPAC name is (4-chlorophenyl) [(bromo-λ3-iodanylidene)-λ3-iodanyl]formate.
Molecular Properties
| Compound Name | (4-chlorophenyl) [(bromo-λ3-iodanylidene)-λ3-iodanyl]formate |
| PubChem CID | 88730372 |
| Molecular Formula | C7H4BrClI2O2 |
| Molecular Weight | 489.27 g/mol |
| Exact Mass | 487.72 |
| IUPAC Name | (4-chlorophenyl) [(bromo-λ3-iodanylidene)-λ3-iodanyl]formate |
| SMILES | O=C(Oc1ccc(Cl)cc1)/I=I/Br |
| InChI | InChI=1S/C7H4BrClI2O2/c8-11-10-7(12)13-6-3-1-5(9)2-4-6/h1-4H |
| InChIKey | DURWHAVWOUFMHP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.27 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl) [(bromo-λ3-iodanylidene)-λ3-iodanyl]formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl) [(bromo-λ3-iodanylidene)-λ3-iodanyl]formate?
The IUPAC name of (4-chlorophenyl) [(bromo-λ3-iodanylidene)-λ3-iodanyl]formate (CID 88730372) is (4-chlorophenyl) [(bromo-λ3-iodanylidene)-λ3-iodanyl]formate.
What is the SMILES notation for (4-chlorophenyl) [(bromo-λ3-iodanylidene)-λ3-iodanyl]formate?
The canonical SMILES for (4-chlorophenyl) [(bromo-λ3-iodanylidene)-λ3-iodanyl]formate is O=C(Oc1ccc(Cl)cc1)/I=I/Br.
What is the InChIKey of (4-chlorophenyl) [(bromo-λ3-iodanylidene)-λ3-iodanyl]formate?
The InChIKey is DURWHAVWOUFMHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrClI2O2/c8-11-10-7(12)13-6-3-1-5(9)2-4-6/h1-4H.
What are the key properties of (4-chlorophenyl) [(bromo-λ3-iodanylidene)-λ3-iodanyl]formate?
(4-chlorophenyl) [(bromo-λ3-iodanylidene)-λ3-iodanyl]formate has a molecular weight of 489.27 g/mol, XLogP of 5.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl) [(bromo-λ3-iodanylidene)-λ3-iodanyl]formate is sourced from PubChem (CID 88730372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).