C22H18N6O5S2 — CID 88732298
(6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(isoquinolin-2-ium-2-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88732298) has the molecular formula C22H18N6O5S2 and a molecular weight of 510.56 g/mol. Its IUPAC name is (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(isoquinolin-2-ium-2-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(isoquinolin-2-ium-2-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88732298 |
| Molecular Formula | C22H18N6O5S2 |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(isoquinolin-2-ium-2-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | Nc1nc(C(=NO)C(=O)NC2C(=O)N3C(C(=O)[O-])=C(C[n+]4ccc5ccccc5c4)CS[C@@H]23)cs1 |
| InChI | InChI=1S/C22H18N6O5S2/c23-22-24-14(10-35-22)15(26-33)18(29)25-16-19(30)28-17(21(31)32)13(9-34-20(16)28)8-27-6-5-11-3-1-2-4-12(11)7-27/h1-7,10,16,20H,8-9H2,(H4-,23,24,25,29,31,32,33)/t16?,20-/m0/s1 |
| InChIKey | QHWSYWKEYNVNFS-FZCLLLDFSA-N |
| XLogP | -0.55 |
| TPSA | 164.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|