C19H17N6NaO5S3 — CID 139680310
sodium (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-(2-pyridin-2-ylsulfanylethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 139680310) has the molecular formula C19H17N6NaO5S3 and a molecular weight of 528.57 g/mol. Its IUPAC name is sodium (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-(2-pyridin-2-ylsulfanylethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | sodium (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-(2-pyridin-2-ylsulfanylethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 139680310 |
| Molecular Formula | C19H17N6NaO5S3 |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.03 |
| IUPAC Name | sodium (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-(2-pyridin-2-ylsulfanylethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | Nc1nc(/C(=N/O)C(=O)N[C@@H]2C(=O)N3C(C(=O)[O-])=C(CCSc4ccccn4)CS[C@H]23)cs1.[Na+] |
| InChI | InChI=1S/C19H18N6O5S3.Na/c20-19-22-10(8-33-19)12(24-30)15(26)23-13-16(27)25-14(18(28)29)9(7-32-17(13)25)4-6-31-11-3-1-2-5-21-11;/h1-3,5,8,13,17,30H,4,6-7H2,(H2,20,22)(H,23,26)(H,28,29);/q;+1/p-1/b24-12-;/t13-,17-;/m1./s1 |
| InChIKey | CDRKMYQCBHNNHR-GRHXURATSA-M |
| XLogP | -3.11 |
| TPSA | 173.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|