C18H14ClF9O3 — CID 88736103
[2-fluoro-5-(trifluoromethoxy)phenyl]methyl 3-(2-chloro-3,3,4,4,4-pentafluorobut-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 88736103) has the molecular formula C18H14ClF9O3 and a molecular weight of 484.74 g/mol. Its IUPAC name is [2-fluoro-5-(trifluoromethoxy)phenyl]methyl 3-(2-chloro-3,3,4,4,4-pentafluorobut-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | [2-fluoro-5-(trifluoromethoxy)phenyl]methyl 3-(2-chloro-3,3,4,4,4-pentafluorobut-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 88736103 |
| Molecular Formula | C18H14ClF9O3 |
| Molecular Weight | 484.74 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | [2-fluoro-5-(trifluoromethoxy)phenyl]methyl 3-(2-chloro-3,3,4,4,4-pentafluorobut-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)C(C=C(Cl)C(F)(F)C(F)(F)F)C1C(=O)OCc1cc(OC(F)(F)F)ccc1F |
| InChI | InChI=1S/C18H14ClF9O3/c1-15(2)10(6-12(19)16(21,22)17(23,24)25)13(15)14(29)30-7-8-5-9(3-4-11(8)20)31-18(26,27)28/h3-6,10,13H,7H2,1-2H3 |
| InChIKey | UZXAJGIAVPMEOJ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.74 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|