C7H13NOS2 — CID 88738462
3-(1-methoxypropyl)-1,3-thiazolidine-2-thione (PubChem CID 88738462) has the molecular formula C7H13NOS2 and a molecular weight of 191.32 g/mol. Its IUPAC name is 3-(1-methoxypropyl)-1,3-thiazolidine-2-thione.
| Compound Name | 3-(1-methoxypropyl)-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 88738462 |
| Molecular Formula | C7H13NOS2 |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 3-(1-methoxypropyl)-1,3-thiazolidine-2-thione |
| SMILES | CCC(OC)N1CCSC1=S |
| InChI | InChI=1S/C7H13NOS2/c1-3-6(9-2)8-4-5-11-7(8)10/h6H,3-5H2,1-2H3 |
| InChIKey | LCWSYKOUAHYDJP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|