C12H25NOS2 — CID 22410967
1-methoxyethyl N,N-dibutylcarbamodithioate (PubChem CID 22410967) has the molecular formula C12H25NOS2 and a molecular weight of 263.47 g/mol. Its IUPAC name is 1-methoxyethyl N,N-dibutylcarbamodithioate.
| Compound Name | 1-methoxyethyl N,N-dibutylcarbamodithioate |
|---|---|
| PubChem CID | 22410967 |
| Molecular Formula | C12H25NOS2 |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 1-methoxyethyl N,N-dibutylcarbamodithioate |
| SMILES | CCCCN(CCCC)C(=S)SC(C)OC |
| InChI | InChI=1S/C12H25NOS2/c1-5-7-9-13(10-8-6-2)12(15)16-11(3)14-4/h11H,5-10H2,1-4H3 |
| InChIKey | YQUCXDSLLUKHTP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|