C19H46N4O5 — CID 88740283
1-(2-aminoethylamino)propan-2-ol;4,5-diamino-4,5-bis(2-hydroxypropyl)octane-2,7-diol (PubChem CID 88740283) has the molecular formula C19H46N4O5 and a molecular weight of 410.60 g/mol. Its IUPAC name is 1-(2-aminoethylamino)propan-2-ol;4,5-diamino-4,5-bis(2-hydroxypropyl)octane-2,7-diol.
| Compound Name | 1-(2-aminoethylamino)propan-2-ol;4,5-diamino-4,5-bis(2-hydroxypropyl)octane-2,7-diol |
|---|---|
| PubChem CID | 88740283 |
| Molecular Formula | C19H46N4O5 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.35 |
| IUPAC Name | 1-(2-aminoethylamino)propan-2-ol;4,5-diamino-4,5-bis(2-hydroxypropyl)octane-2,7-diol |
| SMILES | CC(O)CC(N)(CC(C)O)C(N)(CC(C)O)CC(C)O.CC(O)CNCCN |
| InChI | InChI=1S/C14H32N2O4.C5H14N2O/c1-9(17)5-13(15,6-10(2)18)14(16,7-11(3)19)8-12(4)20;1-5(8)4-7-3-2-6/h9-12,17-20H,5-8,15-16H2,1-4H3;5,7-8H,2-4,6H2,1H3 |
| InChIKey | JTGVMLWJGGNSIQ-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 191.24 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|