About O-prop-2-enyl N-cyanocarbamothioate
O-prop-2-enyl N-cyanocarbamothioate (PubChem CID 88742551) has the molecular formula C5H6N2OS
and a molecular weight of 142.18 g/mol. Its IUPAC name is O-prop-2-enyl N-cyanocarbamothioate.
Molecular Properties
| Compound Name | O-prop-2-enyl N-cyanocarbamothioate |
| PubChem CID | 88742551 |
| Molecular Formula | C5H6N2OS |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.02 |
| IUPAC Name | O-prop-2-enyl N-cyanocarbamothioate |
| SMILES | C=CCOC(=S)NC#N |
| InChI | InChI=1S/C5H6N2OS/c1-2-3-8-5(9)7-4-6/h2H,1,3H2,(H,7,9) |
| InChIKey | ROWNXHBZJZTNSV-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-prop-2-enyl N-cyanocarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-prop-2-enyl N-cyanocarbamothioate?
The IUPAC name of O-prop-2-enyl N-cyanocarbamothioate (CID 88742551) is O-prop-2-enyl N-cyanocarbamothioate.
What is the SMILES notation for O-prop-2-enyl N-cyanocarbamothioate?
The canonical SMILES for O-prop-2-enyl N-cyanocarbamothioate is C=CCOC(=S)NC#N.
What is the InChIKey of O-prop-2-enyl N-cyanocarbamothioate?
The InChIKey is ROWNXHBZJZTNSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2OS/c1-2-3-8-5(9)7-4-6/h2H,1,3H2,(H,7,9).
What are the key properties of O-prop-2-enyl N-cyanocarbamothioate?
O-prop-2-enyl N-cyanocarbamothioate has a molecular weight of 142.18 g/mol, XLogP of 0.54, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-prop-2-enyl N-cyanocarbamothioate is sourced from PubChem (CID 88742551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).