About 1-aminoethenylcyanamide
1-aminoethenylcyanamide (PubChem CID 131531225) has the molecular formula C3H5N3
and a molecular weight of 83.09 g/mol. Its IUPAC name is 1-aminoethenylcyanamide.
Molecular Properties
| Compound Name | 1-aminoethenylcyanamide |
| PubChem CID | 131531225 |
| Molecular Formula | C3H5N3 |
| Molecular Weight | 83.09 g/mol |
| Exact Mass | 83.05 |
| IUPAC Name | 1-aminoethenylcyanamide |
| SMILES | C=C(N)NC#N |
| InChI | InChI=1S/C3H5N3/c1-3(5)6-2-4/h6H,1,5H2 |
| InChIKey | BKEVGXRDJXNKRJ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 83.09 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethenylcyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethenylcyanamide?
The IUPAC name of 1-aminoethenylcyanamide (CID 131531225) is 1-aminoethenylcyanamide.
What is the SMILES notation for 1-aminoethenylcyanamide?
The canonical SMILES for 1-aminoethenylcyanamide is C=C(N)NC#N.
What is the InChIKey of 1-aminoethenylcyanamide?
The InChIKey is BKEVGXRDJXNKRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N3/c1-3(5)6-2-4/h6H,1,5H2.
What are the key properties of 1-aminoethenylcyanamide?
1-aminoethenylcyanamide has a molecular weight of 83.09 g/mol, XLogP of -0.51, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethenylcyanamide is sourced from PubChem (CID 131531225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).