About benzyl(trimethyl)azanium;perchloryl perchlorate;tetraoctylazanium
benzyl(trimethyl)azanium;perchloryl perchlorate;tetraoctylazanium (PubChem CID 88743767) has the molecular formula C42H84Cl2N2O7+2
and a molecular weight of 800.05 g/mol. Its IUPAC name is benzyl(trimethyl)azanium;perchloryl perchlorate;tetraoctylazanium.
Molecular Properties
| Compound Name | benzyl(trimethyl)azanium;perchloryl perchlorate;tetraoctylazanium |
| PubChem CID | 88743767 |
| Molecular Formula | C42H84Cl2N2O7+2 |
| Molecular Weight | 800.05 g/mol |
| Exact Mass | 798.56 |
| IUPAC Name | benzyl(trimethyl)azanium;perchloryl perchlorate;tetraoctylazanium |
| SMILES | CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC.C[N+](C)(C)Cc1ccccc1.[O-][Cl+3]([O-])([O-])O[Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C32H68N.C10H16N.Cl2O7/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;1-11(2,3)9-10-7-5-4-6-8-10;3-1(4,5)9-2(6,7)8/h5-32H2,1-4H3;4-8H,9H2,1-3H3;/q2*+1; |
| InChIKey | VYCLDQWPFZIEMN-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 147.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 800.05 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl(trimethyl)azanium;perchloryl perchlorate;tetraoctylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(trimethyl)azanium;perchloryl perchlorate;tetraoctylazanium?
The IUPAC name of benzyl(trimethyl)azanium;perchloryl perchlorate;tetraoctylazanium (CID 88743767) is benzyl(trimethyl)azanium;perchloryl perchlorate;tetraoctylazanium.
What is the SMILES notation for benzyl(trimethyl)azanium;perchloryl perchlorate;tetraoctylazanium?
The canonical SMILES for benzyl(trimethyl)azanium;perchloryl perchlorate;tetraoctylazanium is CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC.C[N+](C)(C)Cc1ccccc1.[O-][Cl+3]([O-])([O-])O[Cl+3]([O-])([O-])[O-].
What is the InChIKey of benzyl(trimethyl)azanium;perchloryl perchlorate;tetraoctylazanium?
The InChIKey is VYCLDQWPFZIEMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H68N.C10H16N.Cl2O7/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;1-11(2,3)9-10-7-5-4-6-8-10;3-1(4,5)9-2(6,7)8/h5-32H2,1-4H3;4-8H,9H2,1-3H3;/q2*+1;.
What are the key properties of benzyl(trimethyl)azanium;perchloryl perchlorate;tetraoctylazanium?
benzyl(trimethyl)azanium;perchloryl perchlorate;tetraoctylazanium has a molecular weight of 800.05 g/mol, XLogP of 5.94, 32 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(trimethyl)azanium;perchloryl perchlorate;tetraoctylazanium is sourced from PubChem (CID 88743767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).