C18H23NO4S — CID 88746257
(2S,4S)-1-(3-acetylsulfanylpropanoyl)-4-(2-phenylethyl)pyrrolidine-2-carboxylic acid (PubChem CID 88746257) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is (2S,4S)-1-(3-acetylsulfanylpropanoyl)-4-(2-phenylethyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-1-(3-acetylsulfanylpropanoyl)-4-(2-phenylethyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 88746257 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (2S,4S)-1-(3-acetylsulfanylpropanoyl)-4-(2-phenylethyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(=O)SCCC(=O)N1C[C@@H](CCc2ccccc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C18H23NO4S/c1-13(20)24-10-9-17(21)19-12-15(11-16(19)18(22)23)8-7-14-5-3-2-4-6-14/h2-6,15-16H,7-12H2,1H3,(H,22,23)/t15-,16-/m0/s1 |
| InChIKey | WANFMNNWMKTWJO-HOTGVXAUSA-N |
| XLogP | 2.59 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|