C20H14F4N2O2 — CID 88747853
N-(4-fluorophenyl)-N-methyl-2-(2,4,5-trifluoro-3-methylphenoxy)pyridine-3-carboxamide (PubChem CID 88747853) has the molecular formula C20H14F4N2O2 and a molecular weight of 390.34 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N-methyl-2-(2,4,5-trifluoro-3-methylphenoxy)pyridine-3-carboxamide.
| Compound Name | N-(4-fluorophenyl)-N-methyl-2-(2,4,5-trifluoro-3-methylphenoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 88747853 |
| Molecular Formula | C20H14F4N2O2 |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | N-(4-fluorophenyl)-N-methyl-2-(2,4,5-trifluoro-3-methylphenoxy)pyridine-3-carboxamide |
| SMILES | Cc1c(F)c(F)cc(Oc2ncccc2C(=O)N(C)c2ccc(F)cc2)c1F |
| InChI | InChI=1S/C20H14F4N2O2/c1-11-17(23)15(22)10-16(18(11)24)28-19-14(4-3-9-25-19)20(27)26(2)13-7-5-12(21)6-8-13/h3-10H,1-2H3 |
| InChIKey | QGEMKOUQHSJUQL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|