About sodium 2-propylsulfonylacetate
sodium 2-propylsulfonylacetate (PubChem CID 88750537) has the molecular formula C5H9NaO4S
and a molecular weight of 188.18 g/mol. Its IUPAC name is sodium 2-propylsulfonylacetate.
Molecular Properties
| Compound Name | sodium 2-propylsulfonylacetate |
| PubChem CID | 88750537 |
| Molecular Formula | C5H9NaO4S |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.01 |
| IUPAC Name | sodium 2-propylsulfonylacetate |
| SMILES | CCCS(=O)(=O)CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C5H10O4S.Na/c1-2-3-10(8,9)4-5(6)7;/h2-4H2,1H3,(H,6,7);/q;+1/p-1 |
| InChIKey | OHBSKHJOPVRAON-UHFFFAOYSA-M |
| XLogP | -4.43 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium 2-propylsulfonylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-propylsulfonylacetate?
The IUPAC name of sodium 2-propylsulfonylacetate (CID 88750537) is sodium 2-propylsulfonylacetate.
What is the SMILES notation for sodium 2-propylsulfonylacetate?
The canonical SMILES for sodium 2-propylsulfonylacetate is CCCS(=O)(=O)CC(=O)[O-].[Na+].
What is the InChIKey of sodium 2-propylsulfonylacetate?
The InChIKey is OHBSKHJOPVRAON-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H10O4S.Na/c1-2-3-10(8,9)4-5(6)7;/h2-4H2,1H3,(H,6,7);/q;+1/p-1.
What are the key properties of sodium 2-propylsulfonylacetate?
sodium 2-propylsulfonylacetate has a molecular weight of 188.18 g/mol, XLogP of -4.43, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-propylsulfonylacetate is sourced from PubChem (CID 88750537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).