C16H12Br2F4S — CID 88751128
[1-bromo-1-(1-bromo-2,2-difluoro-1-phenylethyl)sulfanyl-2,2-difluoroethyl]benzene (PubChem CID 88751128) has the molecular formula C16H12Br2F4S and a molecular weight of 472.14 g/mol. Its IUPAC name is [1-bromo-1-(1-bromo-2,2-difluoro-1-phenylethyl)sulfanyl-2,2-difluoroethyl]benzene.
| Compound Name | [1-bromo-1-(1-bromo-2,2-difluoro-1-phenylethyl)sulfanyl-2,2-difluoroethyl]benzene |
|---|---|
| PubChem CID | 88751128 |
| Molecular Formula | C16H12Br2F4S |
| Molecular Weight | 472.14 g/mol |
| Exact Mass | 469.90 |
| IUPAC Name | [1-bromo-1-(1-bromo-2,2-difluoro-1-phenylethyl)sulfanyl-2,2-difluoroethyl]benzene |
| SMILES | FC(F)C(Br)(SC(Br)(c1ccccc1)C(F)F)c1ccccc1 |
| InChI | InChI=1S/C16H12Br2F4S/c17-15(13(19)20,11-7-3-1-4-8-11)23-16(18,14(21)22)12-9-5-2-6-10-12/h1-10,13-14H |
| InChIKey | WXDARIUBAPSMHL-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.14 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|