C7H14N4S — CID 88751327
4-(pentylamino)-3H-1,2,4-triazole-5-thione (PubChem CID 88751327) has the molecular formula C7H14N4S and a molecular weight of 186.28 g/mol. Its IUPAC name is 4-(pentylamino)-3H-1,2,4-triazole-5-thione.
| Compound Name | 4-(pentylamino)-3H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 88751327 |
| Molecular Formula | C7H14N4S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 4-(pentylamino)-3H-1,2,4-triazole-5-thione |
| SMILES | CCCCCNN1CN=NC1=S |
| InChI | InChI=1S/C7H14N4S/c1-2-3-4-5-9-11-6-8-10-7(11)12/h9H,2-6H2,1H3 |
| InChIKey | MNODXUZRRWYATR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|