C15H25NO3 — CID 88752849
1-(3,3-dimethyl-1-oxa-5-azaspiro[5.5]undecan-5-yl)butane-1,3-dione (PubChem CID 88752849) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 1-(3,3-dimethyl-1-oxa-5-azaspiro[5.5]undecan-5-yl)butane-1,3-dione.
| Compound Name | 1-(3,3-dimethyl-1-oxa-5-azaspiro[5.5]undecan-5-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 88752849 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 1-(3,3-dimethyl-1-oxa-5-azaspiro[5.5]undecan-5-yl)butane-1,3-dione |
| SMILES | CC(=O)CC(=O)N1CC(C)(C)COC12CCCCC2 |
| InChI | InChI=1S/C15H25NO3/c1-12(17)9-13(18)16-10-14(2,3)11-19-15(16)7-5-4-6-8-15/h4-11H2,1-3H3 |
| InChIKey | IGHWGEIUWDICOG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|