About diethylamino perchlorate
diethylamino perchlorate (PubChem CID 88753558) has the molecular formula C4H10ClNO4
and a molecular weight of 171.58 g/mol. Its IUPAC name is diethylamino perchlorate.
Molecular Properties
| Compound Name | diethylamino perchlorate |
| PubChem CID | 88753558 |
| Molecular Formula | C4H10ClNO4 |
| Molecular Weight | 171.58 g/mol |
| Exact Mass | 171.03 |
| IUPAC Name | diethylamino perchlorate |
| SMILES | CCN(CC)O[Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C4H10ClNO4/c1-3-6(4-2)10-5(7,8)9/h3-4H2,1-2H3 |
| InChIKey | JRXINGGXFDHOIN-UHFFFAOYSA-N |
| XLogP | -2.84 |
| TPSA | 81.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.58 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze diethylamino perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylamino perchlorate?
The IUPAC name of diethylamino perchlorate (CID 88753558) is diethylamino perchlorate.
What is the SMILES notation for diethylamino perchlorate?
The canonical SMILES for diethylamino perchlorate is CCN(CC)O[Cl+3]([O-])([O-])[O-].
What is the InChIKey of diethylamino perchlorate?
The InChIKey is JRXINGGXFDHOIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10ClNO4/c1-3-6(4-2)10-5(7,8)9/h3-4H2,1-2H3.
What are the key properties of diethylamino perchlorate?
diethylamino perchlorate has a molecular weight of 171.58 g/mol, XLogP of -2.84, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethylamino perchlorate is sourced from PubChem (CID 88753558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).