About CID 23334002
CID 23334002 (PubChem CID 23334002) has the molecular formula C13H30N3O3Si
and a molecular weight of 304.49 g/mol.
Molecular Properties
| Compound Name | CID 23334002 |
| PubChem CID | 23334002 |
| Molecular Formula | C13H30N3O3Si |
| Molecular Weight | 304.49 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | — |
| SMILES | CCN(CC)OC([Si])(ON(CC)CC)ON(CC)CC |
| InChI | InChI=1S/C13H30N3O3Si/c1-7-14(8-2)17-13(20,18-15(9-3)10-4)19-16(11-5)12-6/h7-12H2,1-6H3 |
| InChIKey | OEPPKWSFUQYJOW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 23334002 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23334002?
The IUPAC name of CID 23334002 (CID 23334002) is not available.
What is the SMILES notation for CID 23334002?
The canonical SMILES for CID 23334002 is CCN(CC)OC([Si])(ON(CC)CC)ON(CC)CC.
What is the InChIKey of CID 23334002?
The InChIKey is OEPPKWSFUQYJOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30N3O3Si/c1-7-14(8-2)17-13(20,18-15(9-3)10-4)19-16(11-5)12-6/h7-12H2,1-6H3.
What are the key properties of CID 23334002?
CID 23334002 has a molecular weight of 304.49 g/mol, XLogP of 1.59, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23334002 is sourced from PubChem (CID 23334002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).