C17H32N4O2 — CID 88756785
(Z)-3-amino-N-[6-[[(Z)-3-aminobut-2-enoyl]amino]-2,5,5-trimethylhexyl]but-2-enamide (PubChem CID 88756785) has the molecular formula C17H32N4O2 and a molecular weight of 324.47 g/mol. Its IUPAC name is (Z)-3-amino-N-[6-[[(Z)-3-aminobut-2-enoyl]amino]-2,5,5-trimethylhexyl]but-2-enamide.
| Compound Name | (Z)-3-amino-N-[6-[[(Z)-3-aminobut-2-enoyl]amino]-2,5,5-trimethylhexyl]but-2-enamide |
|---|---|
| PubChem CID | 88756785 |
| Molecular Formula | C17H32N4O2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | (Z)-3-amino-N-[6-[[(Z)-3-aminobut-2-enoyl]amino]-2,5,5-trimethylhexyl]but-2-enamide |
| SMILES | C/C(N)=C/C(=O)NCC(C)CCC(C)(C)CNC(=O)/C=C(/C)N |
| InChI | InChI=1S/C17H32N4O2/c1-12(10-20-15(22)8-13(2)18)6-7-17(4,5)11-21-16(23)9-14(3)19/h8-9,12H,6-7,10-11,18-19H2,1-5H3,(H,20,22)(H,21,23)/b13-8-,14-9- |
| InChIKey | JSUUDPJOLVHOSZ-QKPPEBSVSA-N |
| XLogP | 1.39 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|