About ethane-1,2-diol;1-methoxyethyl thiocyanate
ethane-1,2-diol;1-methoxyethyl thiocyanate (PubChem CID 88758814) has the molecular formula C6H13NO3S
and a molecular weight of 179.24 g/mol. Its IUPAC name is ethane-1,2-diol;1-methoxyethyl thiocyanate.
Molecular Properties
| Compound Name | ethane-1,2-diol;1-methoxyethyl thiocyanate |
| PubChem CID | 88758814 |
| Molecular Formula | C6H13NO3S |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | ethane-1,2-diol;1-methoxyethyl thiocyanate |
| SMILES | COC(C)SC#N.OCCO |
| InChI | InChI=1S/C4H7NOS.C2H6O2/c1-4(6-2)7-3-5;3-1-2-4/h4H,1-2H3;3-4H,1-2H2 |
| InChIKey | YNSALNGOYPMKDM-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,2-diol;1-methoxyethyl thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diol;1-methoxyethyl thiocyanate?
The IUPAC name of ethane-1,2-diol;1-methoxyethyl thiocyanate (CID 88758814) is ethane-1,2-diol;1-methoxyethyl thiocyanate.
What is the SMILES notation for ethane-1,2-diol;1-methoxyethyl thiocyanate?
The canonical SMILES for ethane-1,2-diol;1-methoxyethyl thiocyanate is COC(C)SC#N.OCCO.
What is the InChIKey of ethane-1,2-diol;1-methoxyethyl thiocyanate?
The InChIKey is YNSALNGOYPMKDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NOS.C2H6O2/c1-4(6-2)7-3-5;3-1-2-4/h4H,1-2H3;3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;1-methoxyethyl thiocyanate?
ethane-1,2-diol;1-methoxyethyl thiocyanate has a molecular weight of 179.24 g/mol, XLogP of 0.16, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;1-methoxyethyl thiocyanate is sourced from PubChem (CID 88758814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).