C23H42O4S — CID 88759608
6-methoxy-5,6-dioctylcyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 88759608) has the molecular formula C23H42O4S and a molecular weight of 414.65 g/mol. Its IUPAC name is 6-methoxy-5,6-dioctylcyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | 6-methoxy-5,6-dioctylcyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 88759608 |
| Molecular Formula | C23H42O4S |
| Molecular Weight | 414.65 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 6-methoxy-5,6-dioctylcyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | CCCCCCCCC1=CC=CC(S(=O)(=O)O)C1(CCCCCCCC)OC |
| InChI | InChI=1S/C23H42O4S/c1-4-6-8-10-12-14-17-21-18-16-19-22(28(24,25)26)23(21,27-3)20-15-13-11-9-7-5-2/h16,18-19,22H,4-15,17,20H2,1-3H3,(H,24,25,26) |
| InChIKey | MOHWPLVVJUFFTE-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.65 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|