C30H50O4S — CID 88759759
2-ethoxy-2,3-di(nonyl)-1H-naphthalene-1-sulfonic acid (PubChem CID 88759759) has the molecular formula C30H50O4S and a molecular weight of 506.79 g/mol. Its IUPAC name is 2-ethoxy-2,3-di(nonyl)-1H-naphthalene-1-sulfonic acid.
| Compound Name | 2-ethoxy-2,3-di(nonyl)-1H-naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 88759759 |
| Molecular Formula | C30H50O4S |
| Molecular Weight | 506.79 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | 2-ethoxy-2,3-di(nonyl)-1H-naphthalene-1-sulfonic acid |
| SMILES | CCCCCCCCCC1=Cc2ccccc2C(S(=O)(=O)O)C1(CCCCCCCCC)OCC |
| InChI | InChI=1S/C30H50O4S/c1-4-7-9-11-13-15-17-22-27-25-26-21-18-19-23-28(26)29(35(31,32)33)30(27,34-6-3)24-20-16-14-12-10-8-5-2/h18-19,21,23,25,29H,4-17,20,22,24H2,1-3H3,(H,31,32,33) |
| InChIKey | RJOLBXBLHBIRAH-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.79 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|