2-[(1S,2R,5S)-2-hydroxy-5-(3-oxopropyl)cyclopentyl]acetic acid

C10H16O4 — CID 88760179

IUPAC2-[(1S,2R,5S)-2-hydroxy-5-(3-oxopropyl)cyclopentyl]acetic acid
SMILESO=CCC[C@@H]1CC[C@@H](O)[C@H]1CC(=O)O
InChIInChI=1S/C10H16O4/c11-5-1-2-7-3-4-9(12)8(7)6-10(13)14/h5,7-9,12H,1-4,6H2,(H,13,14)/t7-,8+,9-/m1/s1
InChIKeySDQHOGTYQAFPED-HRDYMLBCSA-N
MW200.23 g/mol
LogP0.83
Rot. Bonds5

About 2-[(1S,2R,5S)-2-hydroxy-5-(3-oxopropyl)cyclopentyl]acetic acid

2-[(1S,2R,5S)-2-hydroxy-5-(3-oxopropyl)cyclopentyl]acetic acid (PubChem CID 88760179) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is 2-[(1S,2R,5S)-2-hydroxy-5-(3-oxopropyl)cyclopentyl]acetic acid.

Molecular Properties

Compound Name2-[(1S,2R,5S)-2-hydroxy-5-(3-oxopropyl)cyclopentyl]acetic acid
PubChem CID88760179
Molecular FormulaC10H16O4
Molecular Weight200.23 g/mol
Exact Mass200.10
IUPAC Name2-[(1S,2R,5S)-2-hydroxy-5-(3-oxopropyl)cyclopentyl]acetic acid
SMILESO=CCC[C@@H]1CC[C@@H](O)[C@H]1CC(=O)O
InChIInChI=1S/C10H16O4/c11-5-1-2-7-3-4-9(12)8(7)6-10(13)14/h5,7-9,12H,1-4,6H2,(H,13,14)/t7-,8+,9-/m1/s1
InChIKeySDQHOGTYQAFPED-HRDYMLBCSA-N
XLogP0.83
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.23
LogP ≤ 50.83
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 2-[(1S,2R,5S)-2-hydroxy-5-(3-oxopropyl)cyclopentyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1S,2R,5S)-2-hydroxy-5-(3-oxopropyl)cyclopentyl]acetic acid?
The IUPAC name of 2-[(1S,2R,5S)-2-hydroxy-5-(3-oxopropyl)cyclopentyl]acetic acid (CID 88760179) is 2-[(1S,2R,5S)-2-hydroxy-5-(3-oxopropyl)cyclopentyl]acetic acid.
What is the SMILES notation for 2-[(1S,2R,5S)-2-hydroxy-5-(3-oxopropyl)cyclopentyl]acetic acid?
The canonical SMILES for 2-[(1S,2R,5S)-2-hydroxy-5-(3-oxopropyl)cyclopentyl]acetic acid is O=CCC[C@@H]1CC[C@@H](O)[C@H]1CC(=O)O.
What is the InChIKey of 2-[(1S,2R,5S)-2-hydroxy-5-(3-oxopropyl)cyclopentyl]acetic acid?
The InChIKey is SDQHOGTYQAFPED-HRDYMLBCSA-N. The full InChI is InChI=1S/C10H16O4/c11-5-1-2-7-3-4-9(12)8(7)6-10(13)14/h5,7-9,12H,1-4,6H2,(H,13,14)/t7-,8+,9-/m1/s1.
What are the key properties of 2-[(1S,2R,5S)-2-hydroxy-5-(3-oxopropyl)cyclopentyl]acetic acid?
2-[(1S,2R,5S)-2-hydroxy-5-(3-oxopropyl)cyclopentyl]acetic acid has a molecular weight of 200.23 g/mol, XLogP of 0.83, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,2R,5S)-2-hydroxy-5-(3-oxopropyl)cyclopentyl]acetic acid is sourced from PubChem (CID 88760179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).