C9H14ClN5OS — CID 88761186
1-[2-[(6-chloropyridazin-3-yl)-methylamino]ethylsulfanyl]-3-methylurea (PubChem CID 88761186) has the molecular formula C9H14ClN5OS and a molecular weight of 275.77 g/mol. Its IUPAC name is 1-[2-[(6-chloropyridazin-3-yl)-methylamino]ethylsulfanyl]-3-methylurea.
| Compound Name | 1-[2-[(6-chloropyridazin-3-yl)-methylamino]ethylsulfanyl]-3-methylurea |
|---|---|
| PubChem CID | 88761186 |
| Molecular Formula | C9H14ClN5OS |
| Molecular Weight | 275.77 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 1-[2-[(6-chloropyridazin-3-yl)-methylamino]ethylsulfanyl]-3-methylurea |
| SMILES | CNC(=O)NSCCN(C)c1ccc(Cl)nn1 |
| InChI | InChI=1S/C9H14ClN5OS/c1-11-9(16)14-17-6-5-15(2)8-4-3-7(10)12-13-8/h3-4H,5-6H2,1-2H3,(H2,11,14,16) |
| InChIKey | YJGCKTCQAFTSSA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.77 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|