C17H19ClN4O3 — CID 55649058
[2-oxo-2-(1-phenylethylamino)ethyl] 2-[(6-chloropyridazin-3-yl)-methylamino]acetate (PubChem CID 55649058) has the molecular formula C17H19ClN4O3 and a molecular weight of 362.82 g/mol. Its IUPAC name is [2-oxo-2-(1-phenylethylamino)ethyl] 2-[(6-chloropyridazin-3-yl)-methylamino]acetate.
| Compound Name | [2-oxo-2-(1-phenylethylamino)ethyl] 2-[(6-chloropyridazin-3-yl)-methylamino]acetate |
|---|---|
| PubChem CID | 55649058 |
| Molecular Formula | C17H19ClN4O3 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | [2-oxo-2-(1-phenylethylamino)ethyl] 2-[(6-chloropyridazin-3-yl)-methylamino]acetate |
| SMILES | CC(NC(=O)COC(=O)CN(C)c1ccc(Cl)nn1)c1ccccc1 |
| InChI | InChI=1S/C17H19ClN4O3/c1-12(13-6-4-3-5-7-13)19-16(23)11-25-17(24)10-22(2)15-9-8-14(18)20-21-15/h3-9,12H,10-11H2,1-2H3,(H,19,23) |
| InChIKey | ZDHUIJYGRGKLKC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |