C21H29NO6S — CID 88763976
[1-(4-hydroxyphenyl)-2-[[5-(2-methoxyphenyl)-2-methylpentan-2-yl]amino]ethyl] hydrogen sulfate (PubChem CID 88763976) has the molecular formula C21H29NO6S and a molecular weight of 423.53 g/mol. Its IUPAC name is [1-(4-hydroxyphenyl)-2-[[5-(2-methoxyphenyl)-2-methylpentan-2-yl]amino]ethyl] hydrogen sulfate.
| Compound Name | [1-(4-hydroxyphenyl)-2-[[5-(2-methoxyphenyl)-2-methylpentan-2-yl]amino]ethyl] hydrogen sulfate |
|---|---|
| PubChem CID | 88763976 |
| Molecular Formula | C21H29NO6S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | [1-(4-hydroxyphenyl)-2-[[5-(2-methoxyphenyl)-2-methylpentan-2-yl]amino]ethyl] hydrogen sulfate |
| SMILES | COc1ccccc1CCCC(C)(C)NCC(OS(=O)(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H29NO6S/c1-21(2,14-6-8-16-7-4-5-9-19(16)27-3)22-15-20(28-29(24,25)26)17-10-12-18(23)13-11-17/h4-5,7,9-13,20,22-23H,6,8,14-15H2,1-3H3,(H,24,25,26) |
| InChIKey | PFDOKYVUGBIOQM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|