C21H31NO7S — CID 70565790
4-[1-hydroxy-2-[[5-(2-methoxyphenyl)-2-methylpentan-2-yl]amino]ethyl]phenol;sulfuric acid (PubChem CID 70565790) has the molecular formula C21H31NO7S and a molecular weight of 441.55 g/mol. Its IUPAC name is 4-[1-hydroxy-2-[[5-(2-methoxyphenyl)-2-methylpentan-2-yl]amino]ethyl]phenol;sulfuric acid.
| Compound Name | 4-[1-hydroxy-2-[[5-(2-methoxyphenyl)-2-methylpentan-2-yl]amino]ethyl]phenol;sulfuric acid |
|---|---|
| PubChem CID | 70565790 |
| Molecular Formula | C21H31NO7S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 4-[1-hydroxy-2-[[5-(2-methoxyphenyl)-2-methylpentan-2-yl]amino]ethyl]phenol;sulfuric acid |
| SMILES | COc1ccccc1CCCC(C)(C)NCC(O)c1ccc(O)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C21H29NO3.H2O4S/c1-21(2,14-6-8-17-7-4-5-9-20(17)25-3)22-15-19(24)16-10-12-18(23)13-11-16;1-5(2,3)4/h4-5,7,9-13,19,22-24H,6,8,14-15H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | KTFSOZTZYWAZIZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|