About 1-iodopropylcarbamic acid;hydroiodide
1-iodopropylcarbamic acid;hydroiodide (PubChem CID 88765505) has the molecular formula C4H9I2NO2
and a molecular weight of 356.93 g/mol. Its IUPAC name is 1-iodopropylcarbamic acid;hydroiodide.
Molecular Properties
| Compound Name | 1-iodopropylcarbamic acid;hydroiodide |
| PubChem CID | 88765505 |
| Molecular Formula | C4H9I2NO2 |
| Molecular Weight | 356.93 g/mol |
| Exact Mass | 356.87 |
| IUPAC Name | 1-iodopropylcarbamic acid;hydroiodide |
| SMILES | CCC(I)NC(=O)O.I |
| InChI | InChI=1S/C4H8INO2.HI/c1-2-3(5)6-4(7)8;/h3,6H,2H2,1H3,(H,7,8);1H |
| InChIKey | BCGNGHYEKVOKRF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.93 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-iodopropylcarbamic acid;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodopropylcarbamic acid;hydroiodide?
The IUPAC name of 1-iodopropylcarbamic acid;hydroiodide (CID 88765505) is 1-iodopropylcarbamic acid;hydroiodide.
What is the SMILES notation for 1-iodopropylcarbamic acid;hydroiodide?
The canonical SMILES for 1-iodopropylcarbamic acid;hydroiodide is CCC(I)NC(=O)O.I.
What is the InChIKey of 1-iodopropylcarbamic acid;hydroiodide?
The InChIKey is BCGNGHYEKVOKRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8INO2.HI/c1-2-3(5)6-4(7)8;/h3,6H,2H2,1H3,(H,7,8);1H.
What are the key properties of 1-iodopropylcarbamic acid;hydroiodide?
1-iodopropylcarbamic acid;hydroiodide has a molecular weight of 356.93 g/mol, XLogP of 2.04, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodopropylcarbamic acid;hydroiodide is sourced from PubChem (CID 88765505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).