C13H14ClNO3 — CID 88768914
(1R)-3-[(E)-(4-chlorophenoxy)iminomethyl]-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 88768914) has the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. Its IUPAC name is (1R)-3-[(E)-(4-chlorophenoxy)iminomethyl]-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | (1R)-3-[(E)-(4-chlorophenoxy)iminomethyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 88768914 |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | (1R)-3-[(E)-(4-chlorophenoxy)iminomethyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC1(C)C(/C=N/Oc2ccc(Cl)cc2)[C@H]1C(=O)O |
| InChI | InChI=1S/C13H14ClNO3/c1-13(2)10(11(13)12(16)17)7-15-18-9-5-3-8(14)4-6-9/h3-7,10-11H,1-2H3,(H,16,17)/b15-7+/t10?,11-/m0/s1 |
| InChIKey | JHJARFDOHKQYQB-DDKGTAORSA-N |
| XLogP | 3.06 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|