C10H10N6O3S2 — CID 88769463
(6S,7S)-7-amino-3-(1-methyltetrazole-5-carbothioyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88769463) has the molecular formula C10H10N6O3S2 and a molecular weight of 326.36 g/mol. Its IUPAC name is (6S,7S)-7-amino-3-(1-methyltetrazole-5-carbothioyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7S)-7-amino-3-(1-methyltetrazole-5-carbothioyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88769463 |
| Molecular Formula | C10H10N6O3S2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | (6S,7S)-7-amino-3-(1-methyltetrazole-5-carbothioyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | Cn1nnnc1C(=S)C1=C(C(=O)O)N2C(=O)[C@H](N)[C@@H]2SC1 |
| InChI | InChI=1S/C10H10N6O3S2/c1-15-7(12-13-14-15)6(20)3-2-21-9-4(11)8(17)16(9)5(3)10(18)19/h4,9H,2,11H2,1H3,(H,18,19)/t4-,9-/m0/s1 |
| InChIKey | OWRDZHZASHNPEQ-IGJIYHIXSA-N |
| XLogP | -1.49 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|