C11H14N4O5S — CID 88820663
(6R,7R)-7-amino-3-[(Z)-N-(2-amino-2-oxoethoxy)-C-methylcarbonimidoyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88820663) has the molecular formula C11H14N4O5S and a molecular weight of 314.32 g/mol. Its IUPAC name is (6R,7R)-7-amino-3-[(Z)-N-(2-amino-2-oxoethoxy)-C-methylcarbonimidoyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-7-amino-3-[(Z)-N-(2-amino-2-oxoethoxy)-C-methylcarbonimidoyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88820663 |
| Molecular Formula | C11H14N4O5S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (6R,7R)-7-amino-3-[(Z)-N-(2-amino-2-oxoethoxy)-C-methylcarbonimidoyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | C/C(=N/OCC(N)=O)C1=C(C(=O)O)N2C(=O)[C@@H](N)[C@H]2SC1 |
| InChI | InChI=1S/C11H14N4O5S/c1-4(14-20-2-6(12)16)5-3-21-10-7(13)9(17)15(10)8(5)11(18)19/h7,10H,2-3,13H2,1H3,(H2,12,16)(H,18,19)/b14-4-/t7-,10-/m1/s1 |
| InChIKey | GXYFAPPRPMUONC-OCWBEASOSA-N |
| XLogP | -1.55 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|