C18H21NO5 — CID 88772153
2-[4-[(E)-C-(furan-2-yl)-N-propoxycarbonimidoyl]phenoxy]-2-methylpropanoic acid (PubChem CID 88772153) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is 2-[4-[(E)-C-(furan-2-yl)-N-propoxycarbonimidoyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[(E)-C-(furan-2-yl)-N-propoxycarbonimidoyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 88772153 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-[4-[(E)-C-(furan-2-yl)-N-propoxycarbonimidoyl]phenoxy]-2-methylpropanoic acid |
| SMILES | CCCO/N=C(\c1ccc(OC(C)(C)C(=O)O)cc1)c1ccco1 |
| InChI | InChI=1S/C18H21NO5/c1-4-11-23-19-16(15-6-5-12-22-15)13-7-9-14(10-8-13)24-18(2,3)17(20)21/h5-10,12H,4,11H2,1-3H3,(H,20,21)/b19-16+ |
| InChIKey | CWLPJPUJPBJOBQ-KNTRCKAVSA-N |
| XLogP | 3.70 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|