C18H27N2O+ — CID 8877333
N-[2-(cyclohexen-1-yl)ethyl]-2-(4-propylpyridin-1-ium-1-yl)acetamide (PubChem CID 8877333) has the molecular formula C18H27N2O+ and a molecular weight of 287.43 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(4-propylpyridin-1-ium-1-yl)acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(4-propylpyridin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8877333 |
| Molecular Formula | C18H27N2O+ |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(4-propylpyridin-1-ium-1-yl)acetamide |
| SMILES | CCCc1cc[n+](CC(=O)NCCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C18H26N2O/c1-2-6-16-10-13-20(14-11-16)15-18(21)19-12-9-17-7-4-3-5-8-17/h7,10-11,13-14H,2-6,8-9,12,15H2,1H3/p+1 |
| InChIKey | AZVMTENVYKAQLL-UHFFFAOYSA-O |
| XLogP | 2.93 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|