C13H23NO3 — CID 88774928
trans-(1R,3S)-2,2-dimethyl-3-[2-(2-methylpropoxyimino)propyl]cyclopropane-1-carboxylic acid (PubChem CID 88774928) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is trans-(1R,3S)-2,2-dimethyl-3-[2-(2-methylpropoxyimino)propyl]cyclopropane-1-carboxylic acid.
| Compound Name | trans-(1R,3S)-2,2-dimethyl-3-[2-(2-methylpropoxyimino)propyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 88774928 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | trans-(1R,3S)-2,2-dimethyl-3-[2-(2-methylpropoxyimino)propyl]cyclopropane-1-carboxylic acid |
| SMILES | CC(C[C@H]1[C@@H](C(=O)O)C1(C)C)=NOCC(C)C |
| InChI | InChI=1S/C13H23NO3/c1-8(2)7-17-14-9(3)6-10-11(12(15)16)13(10,4)5/h8,10-11H,6-7H2,1-5H3,(H,15,16)/t10-,11-/m0/s1 |
| InChIKey | QEZYKOSSNDLDLV-QWRGUYRKSA-N |
| XLogP | 2.78 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|