C23H51NO5S — CID 88776127
2,2-dihydroxyethyl(octadecyl)azanium;propane-1-sulfonate (PubChem CID 88776127) has the molecular formula C23H51NO5S and a molecular weight of 453.73 g/mol. Its IUPAC name is 2,2-dihydroxyethyl(octadecyl)azanium;propane-1-sulfonate.
| Compound Name | 2,2-dihydroxyethyl(octadecyl)azanium;propane-1-sulfonate |
|---|---|
| PubChem CID | 88776127 |
| Molecular Formula | C23H51NO5S |
| Molecular Weight | 453.73 g/mol |
| Exact Mass | 453.35 |
| IUPAC Name | 2,2-dihydroxyethyl(octadecyl)azanium;propane-1-sulfonate |
| SMILES | CCCCCCCCCCCCCCCCCC[NH2+]CC(O)O.CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C20H43NO2.C3H8O3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-19-20(22)23;1-2-3-7(4,5)6/h20-23H,2-19H2,1H3;2-3H2,1H3,(H,4,5,6) |
| InChIKey | VCBGGNRWSBKEKT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.73 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|