About (cyclohexylamino) oxolan-2-ylmethyl hydrogen phosphate
(cyclohexylamino) oxolan-2-ylmethyl hydrogen phosphate (PubChem CID 88776206) has the molecular formula C11H22NO5P
and a molecular weight of 279.27 g/mol. Its IUPAC name is (cyclohexylamino) oxolan-2-ylmethyl hydrogen phosphate.
Molecular Properties
| Compound Name | (cyclohexylamino) oxolan-2-ylmethyl hydrogen phosphate |
| PubChem CID | 88776206 |
| Molecular Formula | C11H22NO5P |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | (cyclohexylamino) oxolan-2-ylmethyl hydrogen phosphate |
| SMILES | O=P(O)(OCC1CCCO1)ONC1CCCCC1 |
| InChI | InChI=1S/C11H22NO5P/c13-18(14,16-9-11-7-4-8-15-11)17-12-10-5-2-1-3-6-10/h10-12H,1-9H2,(H,13,14) |
| InChIKey | RLHYPGQNAQLSGH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (cyclohexylamino) oxolan-2-ylmethyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (cyclohexylamino) oxolan-2-ylmethyl hydrogen phosphate?
The IUPAC name of (cyclohexylamino) oxolan-2-ylmethyl hydrogen phosphate (CID 88776206) is (cyclohexylamino) oxolan-2-ylmethyl hydrogen phosphate.
What is the SMILES notation for (cyclohexylamino) oxolan-2-ylmethyl hydrogen phosphate?
The canonical SMILES for (cyclohexylamino) oxolan-2-ylmethyl hydrogen phosphate is O=P(O)(OCC1CCCO1)ONC1CCCCC1.
What is the InChIKey of (cyclohexylamino) oxolan-2-ylmethyl hydrogen phosphate?
The InChIKey is RLHYPGQNAQLSGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22NO5P/c13-18(14,16-9-11-7-4-8-15-11)17-12-10-5-2-1-3-6-10/h10-12H,1-9H2,(H,13,14).
What are the key properties of (cyclohexylamino) oxolan-2-ylmethyl hydrogen phosphate?
(cyclohexylamino) oxolan-2-ylmethyl hydrogen phosphate has a molecular weight of 279.27 g/mol, XLogP of 2.14, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (cyclohexylamino) oxolan-2-ylmethyl hydrogen phosphate is sourced from PubChem (CID 88776206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).