C13H23O7P — CID 146510113
1-[(2S,3R,5S)-5-(hydroxymethyl)-2-methyloxolan-3-yl]ethenyl [(2S)-oxolan-2-yl]methyl hydrogen phosphate (PubChem CID 146510113) has the molecular formula C13H23O7P and a molecular weight of 322.29 g/mol. Its IUPAC name is 1-[(2S,3R,5S)-5-(hydroxymethyl)-2-methyloxolan-3-yl]ethenyl [(2S)-oxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | 1-[(2S,3R,5S)-5-(hydroxymethyl)-2-methyloxolan-3-yl]ethenyl [(2S)-oxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 146510113 |
| Molecular Formula | C13H23O7P |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 1-[(2S,3R,5S)-5-(hydroxymethyl)-2-methyloxolan-3-yl]ethenyl [(2S)-oxolan-2-yl]methyl hydrogen phosphate |
| SMILES | C=C(OP(=O)(O)OC[C@@H]1CCCO1)[C@@H]1C[C@@H](CO)O[C@H]1C |
| InChI | InChI=1S/C13H23O7P/c1-9-13(6-12(7-14)19-9)10(2)20-21(15,16)18-8-11-4-3-5-17-11/h9,11-14H,2-8H2,1H3,(H,15,16)/t9-,11-,12-,13+/m0/s1 |
| InChIKey | SXBKYKKKACMLKY-XYJRDEOASA-N |
| XLogP | 1.60 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|