C92H183O14P — CID 132993939
[38-(hydroxymethyl)-7,11,15,19,22,26,30,34,43,47,51,55,58,62,66,70-hexadecamethyl-1,4,37,40-tetraoxacyclodoheptacont-2-yl]methyl (2,3,4,5,6-pentahydroxycyclohexyl) hydrogen phosphate (PubChem CID 132993939) has the molecular formula C92H183O14P and a molecular weight of 1544.44 g/mol. Its IUPAC name is [38-(hydroxymethyl)-7,11,15,19,22,26,30,34,43,47,51,55,58,62,66,70-hexadecamethyl-1,4,37,40-tetraoxacyclodoheptacont-2-yl]methyl (2,3,4,5,6-pentahydroxycyclohexyl) hydrogen phosphate.
| Compound Name | [38-(hydroxymethyl)-7,11,15,19,22,26,30,34,43,47,51,55,58,62,66,70-hexadecamethyl-1,4,37,40-tetraoxacyclodoheptacont-2-yl]methyl (2,3,4,5,6-pentahydroxycyclohexyl) hydrogen phosphate |
|---|---|
| PubChem CID | 132993939 |
| Molecular Formula | C92H183O14P |
| Molecular Weight | 1544.44 g/mol |
| Exact Mass | 1543.33 |
| IUPAC Name | [38-(hydroxymethyl)-7,11,15,19,22,26,30,34,43,47,51,55,58,62,66,70-hexadecamethyl-1,4,37,40-tetraoxacyclodoheptacont-2-yl]methyl (2,3,4,5,6-pentahydroxycyclohexyl) hydrogen phosphate |
| SMILES | CC1CCCC(C)CCCC(C)CCC(C)CCCC(C)CCCC(C)CCCC(C)CCOC(COP(=O)(O)OC2C(O)C(O)C(O)C(O)C2O)COCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC(C)CCCC(C)CCCC(C)CCCC(C)CCOC(CO)COCCC(C)CCC1 |
| InChI | InChI=1S/C92H183O14P/c1-69-29-17-33-73(5)41-25-49-81(13)57-61-101-66-85(65-93)103-63-59-83(15)51-27-43-75(7)35-19-31-71(3)39-23-47-79(11)55-53-78(10)46-22-38-70(2)30-18-34-74(6)42-26-50-82(14)58-62-102-67-86(68-105-107(99,100)106-92-90(97)88(95)87(94)89(96)91(92)98)104-64-60-84(16)52-28-44-76(8)36-20-32-72(4)40-24-48-80(12)56-54-77(9)45-21-37-69/h69-98H,17-68H2,1-16H3,(H,99,100) |
| InChIKey | KRXACJADFVOWSP-UHFFFAOYSA-N |
| XLogP | 23.46 |
| TPSA | 214.06 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 107 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1544.44 |
| LogP ≤ 5 | 23.46 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|