C86H170O6 — CID 102319027
[9-(hydroxymethyl)-5,14,18,22,26,29,33,37,41,50,54,58,62,65,69-pentadecamethyl-8,11,44,47-tetraoxabicyclo[68.2.1]triheptacontan-45-yl]methanol (PubChem CID 102319027) has the molecular formula C86H170O6 and a molecular weight of 1300.30 g/mol. Its IUPAC name is [9-(hydroxymethyl)-5,14,18,22,26,29,33,37,41,50,54,58,62,65,69-pentadecamethyl-8,11,44,47-tetraoxabicyclo[68.2.1]triheptacontan-45-yl]methanol.
| Compound Name | [9-(hydroxymethyl)-5,14,18,22,26,29,33,37,41,50,54,58,62,65,69-pentadecamethyl-8,11,44,47-tetraoxabicyclo[68.2.1]triheptacontan-45-yl]methanol |
|---|---|
| PubChem CID | 102319027 |
| Molecular Formula | C86H170O6 |
| Molecular Weight | 1300.30 g/mol |
| Exact Mass | 1299.30 |
| IUPAC Name | [9-(hydroxymethyl)-5,14,18,22,26,29,33,37,41,50,54,58,62,65,69-pentadecamethyl-8,11,44,47-tetraoxabicyclo[68.2.1]triheptacontan-45-yl]methanol |
| SMILES | CC1CCCC(C)CCCC(C)CCC(C)CCCC(C)C2CCC(CCCC(C)CCOC(CO)COCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC(C)CCCC(C)CCCC(C)CCCC(C)CCOC(CO)COCCC(C)CCC1)C2 |
| InChI | InChI=1S/C86H170O6/c1-68-27-16-30-71(4)37-23-43-79(12)56-60-90-67-86(65-88)92-62-58-81(14)46-26-48-83-53-54-84(63-83)82(15)47-25-45-77(10)52-51-76(9)41-21-35-69(2)28-17-31-72(5)36-22-42-78(11)55-59-89-66-85(64-87)91-61-57-80(13)44-24-38-73(6)32-18-29-70(3)34-20-40-75(8)50-49-74(7)39-19-33-68/h68-88H,16-67H2,1-15H3 |
| InChIKey | UGMSKANKNVUMAS-UHFFFAOYSA-N |
| XLogP | 25.74 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 92 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1300.30 |
| LogP ≤ 5 | 25.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |