C90H174N2O5 — CID 176917788
[2,6,9,13,21,30,38,42,45,49,50,52,56,65-tetradecamethyl-61-(piperazin-1-ylmethyl)-24,27,59,62-tetraoxatetracyclo[67.2.1.114,17.134,37]tetraheptacontan-25-yl]methanol (PubChem CID 176917788) has the molecular formula C90H174N2O5 and a molecular weight of 1364.39 g/mol. Its IUPAC name is [2,6,9,13,21,30,38,42,45,49,50,52,56,65-tetradecamethyl-61-(piperazin-1-ylmethyl)-24,27,59,62-tetraoxatetracyclo[67.2.1.114,17.134,37]tetraheptacontan-25-yl]methanol.
| Compound Name | [2,6,9,13,21,30,38,42,45,49,50,52,56,65-tetradecamethyl-61-(piperazin-1-ylmethyl)-24,27,59,62-tetraoxatetracyclo[67.2.1.114,17.134,37]tetraheptacontan-25-yl]methanol |
|---|---|
| PubChem CID | 176917788 |
| Molecular Formula | C90H174N2O5 |
| Molecular Weight | 1364.39 g/mol |
| Exact Mass | 1363.34 |
| IUPAC Name | [2,6,9,13,21,30,38,42,45,49,50,52,56,65-tetradecamethyl-61-(piperazin-1-ylmethyl)-24,27,59,62-tetraoxatetracyclo[67.2.1.114,17.134,37]tetraheptacontan-25-yl]methanol |
| SMILES | CC1CCCC2CCC(C2)C(C)CCCC(C)CCC(C)CCCC(C)C(C)CC(C)CCCC(C)CCOCC(CN2CCNCC2)OCCC(C)CCCC2CCC(C2)C(C)CCCC(C)CCC(C)CCCC(C)C2CCC(CCCC(C)CCOC(CO)COCC1)C2 |
| InChI | InChI=1S/C90H174N2O5/c1-69-24-16-32-78(10)82(14)61-77(9)31-15-23-73(5)49-57-94-67-89(65-92-55-53-91-54-56-92)96-59-51-75(7)29-21-37-84-44-47-87(63-84)80(12)34-18-26-71(3)41-42-72(4)27-19-35-81(13)88-48-45-85(64-88)38-22-30-76(8)52-60-97-90(66-93)68-95-58-50-74(6)28-20-36-83-43-46-86(62-83)79(11)33-17-25-70(2)40-39-69/h69-91,93H,15-68H2,1-14H3 |
| InChIKey | BYMQETKOZONXPY-UHFFFAOYSA-N |
| XLogP | 24.73 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 97 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1364.39 |
| LogP ≤ 5 | 24.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |