C46H93O8P — CID 165368745
[(2R)-2,3-dihydroxypropyl] [(2S,7R,11R,15S,26S,30R,34R)-7,11,15,19,22,26,30,34-octamethyl-1,4-dioxacyclohexatriacont-2-yl]methyl hydrogen phosphate (PubChem CID 165368745) has the molecular formula C46H93O8P and a molecular weight of 805.22 g/mol. Its IUPAC name is [(2R)-2,3-dihydroxypropyl] [(2S,7R,11R,15S,26S,30R,34R)-7,11,15,19,22,26,30,34-octamethyl-1,4-dioxacyclohexatriacont-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R)-2,3-dihydroxypropyl] [(2S,7R,11R,15S,26S,30R,34R)-7,11,15,19,22,26,30,34-octamethyl-1,4-dioxacyclohexatriacont-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 165368745 |
| Molecular Formula | C46H93O8P |
| Molecular Weight | 805.22 g/mol |
| Exact Mass | 804.66 |
| IUPAC Name | [(2R)-2,3-dihydroxypropyl] [(2S,7R,11R,15S,26S,30R,34R)-7,11,15,19,22,26,30,34-octamethyl-1,4-dioxacyclohexatriacont-2-yl]methyl hydrogen phosphate |
| SMILES | CC1CCC[C@@H](C)CCC[C@@H](C)CCC[C@@H](C)CCOC[C@@H](COP(=O)(O)OC[C@H](O)CO)OCC[C@H](C)CCC[C@H](C)CCC[C@H](C)CCCC(C)CC1 |
| InChI | InChI=1S/C46H93O8P/c1-37-15-9-17-39(3)21-13-25-43(7)29-31-51-35-46(36-54-55(49,50)53-34-45(48)33-47)52-32-30-44(8)26-14-22-40(4)18-10-16-38(2)20-12-24-42(6)28-27-41(5)23-11-19-37/h37-48H,9-36H2,1-8H3,(H,49,50)/t37-,38-,39+,40+,41?,42?,43+,44+,45+,46-/m0/s1 |
| InChIKey | LOGBXQDBRUPWTK-HJHXRGTFSA-N |
| XLogP | 12.56 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.22 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|