About 3-methylbutan-1-amine;1-methylsulfanylpropane
3-methylbutan-1-amine;1-methylsulfanylpropane (PubChem CID 88778818) has the molecular formula C9H23NS
and a molecular weight of 177.36 g/mol. Its IUPAC name is 3-methylbutan-1-amine;1-methylsulfanylpropane.
Molecular Properties
| Compound Name | 3-methylbutan-1-amine;1-methylsulfanylpropane |
| PubChem CID | 88778818 |
| Molecular Formula | C9H23NS |
| Molecular Weight | 177.36 g/mol |
| Exact Mass | 177.16 |
| IUPAC Name | 3-methylbutan-1-amine;1-methylsulfanylpropane |
| SMILES | CC(C)CCN.CCCSC |
| InChI | InChI=1S/C5H13N.C4H10S/c1-5(2)3-4-6;1-3-4-5-2/h5H,3-4,6H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | QBYHIAQGWOTTMM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylbutan-1-amine;1-methylsulfanylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutan-1-amine;1-methylsulfanylpropane?
The IUPAC name of 3-methylbutan-1-amine;1-methylsulfanylpropane (CID 88778818) is 3-methylbutan-1-amine;1-methylsulfanylpropane.
What is the SMILES notation for 3-methylbutan-1-amine;1-methylsulfanylpropane?
The canonical SMILES for 3-methylbutan-1-amine;1-methylsulfanylpropane is CC(C)CCN.CCCSC.
What is the InChIKey of 3-methylbutan-1-amine;1-methylsulfanylpropane?
The InChIKey is QBYHIAQGWOTTMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N.C4H10S/c1-5(2)3-4-6;1-3-4-5-2/h5H,3-4,6H2,1-2H3;3-4H2,1-2H3.
What are the key properties of 3-methylbutan-1-amine;1-methylsulfanylpropane?
3-methylbutan-1-amine;1-methylsulfanylpropane has a molecular weight of 177.36 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutan-1-amine;1-methylsulfanylpropane is sourced from PubChem (CID 88778818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).