About 3-methylbutan-1-amine;2-methyl-2-methylsulfanylpropane
3-methylbutan-1-amine;2-methyl-2-methylsulfanylpropane (PubChem CID 178163372) has the molecular formula C10H25NS
and a molecular weight of 191.38 g/mol. Its IUPAC name is 3-methylbutan-1-amine;2-methyl-2-methylsulfanylpropane.
Molecular Properties
| Compound Name | 3-methylbutan-1-amine;2-methyl-2-methylsulfanylpropane |
| PubChem CID | 178163372 |
| Molecular Formula | C10H25NS |
| Molecular Weight | 191.38 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 3-methylbutan-1-amine;2-methyl-2-methylsulfanylpropane |
| SMILES | CC(C)CCN.CSC(C)(C)C |
| InChI | InChI=1S/C5H13N.C5H12S/c1-5(2)3-4-6;1-5(2,3)6-4/h5H,3-4,6H2,1-2H3;1-4H3 |
| InChIKey | RHVQRKUJRNVMKB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylbutan-1-amine;2-methyl-2-methylsulfanylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutan-1-amine;2-methyl-2-methylsulfanylpropane?
The IUPAC name of 3-methylbutan-1-amine;2-methyl-2-methylsulfanylpropane (CID 178163372) is 3-methylbutan-1-amine;2-methyl-2-methylsulfanylpropane.
What is the SMILES notation for 3-methylbutan-1-amine;2-methyl-2-methylsulfanylpropane?
The canonical SMILES for 3-methylbutan-1-amine;2-methyl-2-methylsulfanylpropane is CC(C)CCN.CSC(C)(C)C.
What is the InChIKey of 3-methylbutan-1-amine;2-methyl-2-methylsulfanylpropane?
The InChIKey is RHVQRKUJRNVMKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N.C5H12S/c1-5(2)3-4-6;1-5(2,3)6-4/h5H,3-4,6H2,1-2H3;1-4H3.
What are the key properties of 3-methylbutan-1-amine;2-methyl-2-methylsulfanylpropane?
3-methylbutan-1-amine;2-methyl-2-methylsulfanylpropane has a molecular weight of 191.38 g/mol, XLogP of 3.14, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutan-1-amine;2-methyl-2-methylsulfanylpropane is sourced from PubChem (CID 178163372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).