C23H34ClN — CID 88779822
benzyl-dimethyl-(2-octan-4-ylphenyl)azanium chloride (PubChem CID 88779822) has the molecular formula C23H34ClN and a molecular weight of 359.99 g/mol. Its IUPAC name is benzyl-dimethyl-(2-octan-4-ylphenyl)azanium chloride.
| Compound Name | benzyl-dimethyl-(2-octan-4-ylphenyl)azanium chloride |
|---|---|
| PubChem CID | 88779822 |
| Molecular Formula | C23H34ClN |
| Molecular Weight | 359.99 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | benzyl-dimethyl-(2-octan-4-ylphenyl)azanium chloride |
| SMILES | CCCCC(CCC)c1ccccc1[N+](C)(C)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C23H34N.ClH/c1-5-7-16-21(13-6-2)22-17-11-12-18-23(22)24(3,4)19-20-14-9-8-10-15-20;/h8-12,14-15,17-18,21H,5-7,13,16,19H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | UWAJSQWDEYRZJB-UHFFFAOYSA-M |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.99 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|