About cobalt;nickel;octanoic acid
cobalt;nickel;octanoic acid (PubChem CID 88782516) has the molecular formula C8H16CoNiO2
and a molecular weight of 261.84 g/mol. Its IUPAC name is cobalt;nickel;octanoic acid.
Molecular Properties
| Compound Name | cobalt;nickel;octanoic acid |
| PubChem CID | 88782516 |
| Molecular Formula | C8H16CoNiO2 |
| Molecular Weight | 261.84 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | cobalt;nickel;octanoic acid |
| SMILES | CCCCCCCC(=O)O.[Co].[Ni] |
| InChI | InChI=1S/C8H16O2.Co.Ni/c1-2-3-4-5-6-7-8(9)10;;/h2-7H2,1H3,(H,9,10);; |
| InChIKey | YXHVDEOENQEIBZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.84 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cobalt;nickel;octanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;nickel;octanoic acid?
The IUPAC name of cobalt;nickel;octanoic acid (CID 88782516) is cobalt;nickel;octanoic acid.
What is the SMILES notation for cobalt;nickel;octanoic acid?
The canonical SMILES for cobalt;nickel;octanoic acid is CCCCCCCC(=O)O.[Co].[Ni].
What is the InChIKey of cobalt;nickel;octanoic acid?
The InChIKey is YXHVDEOENQEIBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.Co.Ni/c1-2-3-4-5-6-7-8(9)10;;/h2-7H2,1H3,(H,9,10);;.
What are the key properties of cobalt;nickel;octanoic acid?
cobalt;nickel;octanoic acid has a molecular weight of 261.84 g/mol, XLogP of 2.43, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;nickel;octanoic acid is sourced from PubChem (CID 88782516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).