C11H17NO3 — CID 88786065
2-phenyl-2-(propan-2-ylamino)ethane-1,1,1-triol (PubChem CID 88786065) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-phenyl-2-(propan-2-ylamino)ethane-1,1,1-triol.
| Compound Name | 2-phenyl-2-(propan-2-ylamino)ethane-1,1,1-triol |
|---|---|
| PubChem CID | 88786065 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-phenyl-2-(propan-2-ylamino)ethane-1,1,1-triol |
| SMILES | CC(C)NC(c1ccccc1)C(O)(O)O |
| InChI | InChI=1S/C11H17NO3/c1-8(2)12-10(11(13,14)15)9-6-4-3-5-7-9/h3-8,10,12-15H,1-2H3 |
| InChIKey | NUFWLSXBGNHHAO-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|