C13H13N3O11S4 — CID 88789240
N-(disulfanyl)formamide;bis(3-nitrobenzenesulfonic acid) (PubChem CID 88789240) has the molecular formula C13H13N3O11S4 and a molecular weight of 515.53 g/mol. Its IUPAC name is N-(disulfanyl)formamide;bis(3-nitrobenzenesulfonic acid).
| Compound Name | N-(disulfanyl)formamide;bis(3-nitrobenzenesulfonic acid) |
|---|---|
| PubChem CID | 88789240 |
| Molecular Formula | C13H13N3O11S4 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 514.94 |
| IUPAC Name | N-(disulfanyl)formamide;bis(3-nitrobenzenesulfonic acid) |
| SMILES | O=CNSS.O=[N+]([O-])c1cccc(S(=O)(=O)O)c1.O=[N+]([O-])c1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/2C6H5NO5S.CH3NOS2/c2*8-7(9)5-2-1-3-6(4-5)13(10,11)12;3-1-2-5-4/h2*1-4H,(H,10,11,12);1,4H,(H,2,3) |
| InChIKey | KQFOJFVSTXHMEQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 224.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|