About [(E)-[3,3-dimethyl-1-(1-methylimidazol-2-yl)sulfanylbutan-2-ylidene]amino] N-methylcarbamate
[(E)-[3,3-dimethyl-1-(1-methylimidazol-2-yl)sulfanylbutan-2-ylidene]amino] N-methylcarbamate (PubChem CID 88794477) has the molecular formula C12H20N4O2S
and a molecular weight of 284.39 g/mol. Its IUPAC name is [(E)-[3,3-dimethyl-1-(1-methylimidazol-2-yl)sulfanylbutan-2-ylidene]amino] N-methylcarbamate.
Molecular Properties
| Compound Name | [(E)-[3,3-dimethyl-1-(1-methylimidazol-2-yl)sulfanylbutan-2-ylidene]amino] N-methylcarbamate |
| PubChem CID | 88794477 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | [(E)-[3,3-dimethyl-1-(1-methylimidazol-2-yl)sulfanylbutan-2-ylidene]amino] N-methylcarbamate |
| SMILES | CNC(=O)O/N=C(/CSc1nccn1C)C(C)(C)C |
| InChI | InChI=1S/C12H20N4O2S/c1-12(2,3)9(15-18-11(17)13-4)8-19-10-14-6-7-16(10)5/h6-7H,8H2,1-5H3,(H,13,17)/b15-9- |
| InChIKey | LACBEUSJWPPJJY-DHDCSXOGSA-N |
| XLogP | 2.27 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[3,3-dimethyl-1-(1-methylimidazol-2-yl)sulfanylbutan-2-ylidene]amino] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[3,3-dimethyl-1-(1-methylimidazol-2-yl)sulfanylbutan-2-ylidene]amino] N-methylcarbamate?
The IUPAC name of [(E)-[3,3-dimethyl-1-(1-methylimidazol-2-yl)sulfanylbutan-2-ylidene]amino] N-methylcarbamate (CID 88794477) is [(E)-[3,3-dimethyl-1-(1-methylimidazol-2-yl)sulfanylbutan-2-ylidene]amino] N-methylcarbamate.
What is the SMILES notation for [(E)-[3,3-dimethyl-1-(1-methylimidazol-2-yl)sulfanylbutan-2-ylidene]amino] N-methylcarbamate?
The canonical SMILES for [(E)-[3,3-dimethyl-1-(1-methylimidazol-2-yl)sulfanylbutan-2-ylidene]amino] N-methylcarbamate is CNC(=O)O/N=C(/CSc1nccn1C)C(C)(C)C.
What is the InChIKey of [(E)-[3,3-dimethyl-1-(1-methylimidazol-2-yl)sulfanylbutan-2-ylidene]amino] N-methylcarbamate?
The InChIKey is LACBEUSJWPPJJY-DHDCSXOGSA-N. The full InChI is InChI=1S/C12H20N4O2S/c1-12(2,3)9(15-18-11(17)13-4)8-19-10-14-6-7-16(10)5/h6-7H,8H2,1-5H3,(H,13,17)/b15-9-.
What are the key properties of [(E)-[3,3-dimethyl-1-(1-methylimidazol-2-yl)sulfanylbutan-2-ylidene]amino] N-methylcarbamate?
[(E)-[3,3-dimethyl-1-(1-methylimidazol-2-yl)sulfanylbutan-2-ylidene]amino] N-methylcarbamate has a molecular weight of 284.39 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[3,3-dimethyl-1-(1-methylimidazol-2-yl)sulfanylbutan-2-ylidene]amino] N-methylcarbamate is sourced from PubChem (CID 88794477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).