About 1H-indole;4H-quinolizine
1H-indole;4H-quinolizine (PubChem CID 88794738) has the molecular formula C17H16N2
and a molecular weight of 248.33 g/mol. Its IUPAC name is 1H-indole;4H-quinolizine.
Molecular Properties
| Compound Name | 1H-indole;4H-quinolizine |
| PubChem CID | 88794738 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1H-indole;4H-quinolizine |
| SMILES | C1=CCN2C=CC=CC2=C1.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C9H9N.C8H7N/c1-3-7-10-8-4-2-6-9(10)5-1;1-2-4-8-7(3-1)5-6-9-8/h1-7H,8H2;1-6,9H |
| InChIKey | RXNBRLPSZOMMNI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-indole;4H-quinolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;4H-quinolizine?
The IUPAC name of 1H-indole;4H-quinolizine (CID 88794738) is 1H-indole;4H-quinolizine.
What is the SMILES notation for 1H-indole;4H-quinolizine?
The canonical SMILES for 1H-indole;4H-quinolizine is C1=CCN2C=CC=CC2=C1.c1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indole;4H-quinolizine?
The InChIKey is RXNBRLPSZOMMNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C8H7N/c1-3-7-10-8-4-2-6-9(10)5-1;1-2-4-8-7(3-1)5-6-9-8/h1-7H,8H2;1-6,9H.
What are the key properties of 1H-indole;4H-quinolizine?
1H-indole;4H-quinolizine has a molecular weight of 248.33 g/mol, XLogP of 3.99, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;4H-quinolizine is sourced from PubChem (CID 88794738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).