C32H26N2O7S — CID 88794911
benzhydryl (6R,7S)-3-[C-acetyloxy-N-(2-oxo-1-phenylethenyl)carbonimidoyl]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88794911) has the molecular formula C32H26N2O7S and a molecular weight of 582.63 g/mol. Its IUPAC name is benzhydryl (6R,7S)-3-[C-acetyloxy-N-(2-oxo-1-phenylethenyl)carbonimidoyl]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R,7S)-3-[C-acetyloxy-N-(2-oxo-1-phenylethenyl)carbonimidoyl]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88794911 |
| Molecular Formula | C32H26N2O7S |
| Molecular Weight | 582.63 g/mol |
| Exact Mass | 582.15 |
| IUPAC Name | benzhydryl (6R,7S)-3-[C-acetyloxy-N-(2-oxo-1-phenylethenyl)carbonimidoyl]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CO[C@H]1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=C(/C(=N\C(=C=O)c3ccccc3)OC(C)=O)CS[C@H]12 |
| InChI | InChI=1S/C32H26N2O7S/c1-20(36)40-29(33-25(18-35)21-12-6-3-7-13-21)24-19-42-31-28(39-2)30(37)34(31)26(24)32(38)41-27(22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-17,27-28,31H,19H2,1-2H3/b33-29+/t28-,31+/m0/s1 |
| InChIKey | ZYUQKENNGYDJQC-DFJQRKOASA-N |
| XLogP | 4.34 |
| TPSA | 111.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.63 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|